C14H12F2N2O2 — CID 62906485
2-N-(1,3-benzodioxol-5-ylmethyl)-3,4-difluorobenzene-1,2-diamine (PubChem CID 62906485) has the molecular formula C14H12F2N2O2 and a molecular weight of 278.26 g/mol. Its IUPAC name is 2-N-(1,3-benzodioxol-5-ylmethyl)-3,4-difluorobenzene-1,2-diamine.
| Compound Name | 2-N-(1,3-benzodioxol-5-ylmethyl)-3,4-difluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 62906485 |
| Molecular Formula | C14H12F2N2O2 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-N-(1,3-benzodioxol-5-ylmethyl)-3,4-difluorobenzene-1,2-diamine |
| SMILES | Nc1ccc(F)c(F)c1NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H12F2N2O2/c15-9-2-3-10(17)14(13(9)16)18-6-8-1-4-11-12(5-8)20-7-19-11/h1-5,18H,6-7,17H2 |
| InChIKey | PPLLYILJVIGZAN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|