C16H15N3O2 — CID 102624278
2-[2-amino-5-(1,3-benzodioxol-5-ylmethylamino)phenyl]acetonitrile (PubChem CID 102624278) has the molecular formula C16H15N3O2 and a molecular weight of 281.32 g/mol. Its IUPAC name is 2-[2-amino-5-(1,3-benzodioxol-5-ylmethylamino)phenyl]acetonitrile.
| Compound Name | 2-[2-amino-5-(1,3-benzodioxol-5-ylmethylamino)phenyl]acetonitrile |
|---|---|
| PubChem CID | 102624278 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-[2-amino-5-(1,3-benzodioxol-5-ylmethylamino)phenyl]acetonitrile |
| SMILES | N#CCc1cc(NCc2ccc3c(c2)OCO3)ccc1N |
| InChI | InChI=1S/C16H15N3O2/c17-6-5-12-8-13(2-3-14(12)18)19-9-11-1-4-15-16(7-11)21-10-20-15/h1-4,7-8,19H,5,9-10,18H2 |
| InChIKey | DRRVTNRGPBATTI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|