C17H17N3O5 — CID 53370426
4-[2-(1,3-benzodioxol-5-ylmethylamino)-3,4-dioxocyclobuten-1-yl]piperazine-1-carbaldehyde (PubChem CID 53370426) has the molecular formula C17H17N3O5 and a molecular weight of 343.34 g/mol. Its IUPAC name is 4-[2-(1,3-benzodioxol-5-ylmethylamino)-3,4-dioxocyclobuten-1-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[2-(1,3-benzodioxol-5-ylmethylamino)-3,4-dioxocyclobuten-1-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 53370426 |
| Molecular Formula | C17H17N3O5 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 4-[2-(1,3-benzodioxol-5-ylmethylamino)-3,4-dioxocyclobuten-1-yl]piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(c2c(NCc3ccc4c(c3)OCO4)c(=O)c2=O)CC1 |
| InChI | InChI=1S/C17H17N3O5/c21-9-19-3-5-20(6-4-19)15-14(16(22)17(15)23)18-8-11-1-2-12-13(7-11)25-10-24-12/h1-2,7,9,18H,3-6,8,10H2 |
| InChIKey | SEYSVSXMUSSGBU-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|