C15H24N2O5S — CID 154802558
1-[(5-tert-butylfuran-2-yl)methylsulfamoyl]piperidine-4-carboxylic acid (PubChem CID 154802558) has the molecular formula C15H24N2O5S and a molecular weight of 344.43 g/mol. Its IUPAC name is 1-[(5-tert-butylfuran-2-yl)methylsulfamoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(5-tert-butylfuran-2-yl)methylsulfamoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 154802558 |
| Molecular Formula | C15H24N2O5S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 1-[(5-tert-butylfuran-2-yl)methylsulfamoyl]piperidine-4-carboxylic acid |
| SMILES | CC(C)(C)c1ccc(CNS(=O)(=O)N2CCC(C(=O)O)CC2)o1 |
| InChI | InChI=1S/C15H24N2O5S/c1-15(2,3)13-5-4-12(22-13)10-16-23(20,21)17-8-6-11(7-9-17)14(18)19/h4-5,11,16H,6-10H2,1-3H3,(H,18,19) |
| InChIKey | NODMEWUHAQBDME-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |