C9H16N2O6S — CID 60858730
1-[(2-methoxy-2-oxoethyl)sulfamoyl]piperidine-4-carboxylic acid (PubChem CID 60858730) has the molecular formula C9H16N2O6S and a molecular weight of 280.30 g/mol. Its IUPAC name is 1-[(2-methoxy-2-oxoethyl)sulfamoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(2-methoxy-2-oxoethyl)sulfamoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 60858730 |
| Molecular Formula | C9H16N2O6S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 1-[(2-methoxy-2-oxoethyl)sulfamoyl]piperidine-4-carboxylic acid |
| SMILES | COC(=O)CNS(=O)(=O)N1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C9H16N2O6S/c1-17-8(12)6-10-18(15,16)11-4-2-7(3-5-11)9(13)14/h7,10H,2-6H2,1H3,(H,13,14) |
| InChIKey | CYQVNIFSSCZSEC-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |