C12H24N2O5S — CID 65105801
1-[(2-ethyl-2-hydroxybutyl)sulfamoyl]piperidine-4-carboxylic acid (PubChem CID 65105801) has the molecular formula C12H24N2O5S and a molecular weight of 308.40 g/mol. Its IUPAC name is 1-[(2-ethyl-2-hydroxybutyl)sulfamoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(2-ethyl-2-hydroxybutyl)sulfamoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 65105801 |
| Molecular Formula | C12H24N2O5S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 1-[(2-ethyl-2-hydroxybutyl)sulfamoyl]piperidine-4-carboxylic acid |
| SMILES | CCC(O)(CC)CNS(=O)(=O)N1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C12H24N2O5S/c1-3-12(17,4-2)9-13-20(18,19)14-7-5-10(6-8-14)11(15)16/h10,13,17H,3-9H2,1-2H3,(H,15,16) |
| InChIKey | QAMRYVAJRLVOGK-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |