C20H22F2N2O3S — CID 55549584
N-[(2,4-difluorophenyl)methyl]-N-methyl-2-piperidin-1-ylsulfonylbenzamide (PubChem CID 55549584) has the molecular formula C20H22F2N2O3S and a molecular weight of 408.47 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-N-methyl-2-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-N-methyl-2-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55549584 |
| Molecular Formula | C20H22F2N2O3S |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-N-methyl-2-piperidin-1-ylsulfonylbenzamide |
| SMILES | CN(Cc1ccc(F)cc1F)C(=O)c1ccccc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C20H22F2N2O3S/c1-23(14-15-9-10-16(21)13-18(15)22)20(25)17-7-3-4-8-19(17)28(26,27)24-11-5-2-6-12-24/h3-4,7-10,13H,2,5-6,11-12,14H2,1H3 |
| InChIKey | QSDCVQGKNUSGHT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |