C21H26N2O3S — CID 55918493
N-(3,5-dimethylphenyl)-N-methyl-2-piperidin-1-ylsulfonylbenzamide (PubChem CID 55918493) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-N-methyl-2-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(3,5-dimethylphenyl)-N-methyl-2-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55918493 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N-(3,5-dimethylphenyl)-N-methyl-2-piperidin-1-ylsulfonylbenzamide |
| SMILES | Cc1cc(C)cc(N(C)C(=O)c2ccccc2S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C21H26N2O3S/c1-16-13-17(2)15-18(14-16)22(3)21(24)19-9-5-6-10-20(19)27(25,26)23-11-7-4-8-12-23/h5-6,9-10,13-15H,4,7-8,11-12H2,1-3H3 |
| InChIKey | XVIADKUHHAOLOI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |