C24H26N2O3S — CID 26904308
N,4-dimethyl-N-naphthalen-2-yl-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 26904308) has the molecular formula C24H26N2O3S and a molecular weight of 422.55 g/mol. Its IUPAC name is N,4-dimethyl-N-naphthalen-2-yl-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N,4-dimethyl-N-naphthalen-2-yl-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 26904308 |
| Molecular Formula | C24H26N2O3S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | N,4-dimethyl-N-naphthalen-2-yl-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | Cc1ccc(C(=O)N(C)c2ccc3ccccc3c2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C24H26N2O3S/c1-18-10-11-21(17-23(18)30(28,29)26-14-6-3-7-15-26)24(27)25(2)22-13-12-19-8-4-5-9-20(19)16-22/h4-5,8-13,16-17H,3,6-7,14-15H2,1-2H3 |
| InChIKey | FRRRJLJDOIGFRV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |