C23H30N2O4S — CID 46591480
N-[1-(2-methoxyphenyl)ethyl]-N,4-dimethyl-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 46591480) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is N-[1-(2-methoxyphenyl)ethyl]-N,4-dimethyl-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[1-(2-methoxyphenyl)ethyl]-N,4-dimethyl-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 46591480 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | N-[1-(2-methoxyphenyl)ethyl]-N,4-dimethyl-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | COc1ccccc1C(C)N(C)C(=O)c1ccc(C)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C23H30N2O4S/c1-17-12-13-19(16-22(17)30(27,28)25-14-8-5-9-15-25)23(26)24(3)18(2)20-10-6-7-11-21(20)29-4/h6-7,10-13,16,18H,5,8-9,14-15H2,1-4H3 |
| InChIKey | VPRALAUZNALVIJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |