C21H18ClN3O4S2 — CID 55489045
N'-(2-chlorobenzoyl)-3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)thiophene-2-carbohydrazide (PubChem CID 55489045) has the molecular formula C21H18ClN3O4S2 and a molecular weight of 475.98 g/mol. Its IUPAC name is N'-(2-chlorobenzoyl)-3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)thiophene-2-carbohydrazide.
| Compound Name | N'-(2-chlorobenzoyl)-3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 55489045 |
| Molecular Formula | C21H18ClN3O4S2 |
| Molecular Weight | 475.98 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | N'-(2-chlorobenzoyl)-3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)thiophene-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1sccc1S(=O)(=O)N1CCc2ccccc2C1)c1ccccc1Cl |
| InChI | InChI=1S/C21H18ClN3O4S2/c22-17-8-4-3-7-16(17)20(26)23-24-21(27)19-18(10-12-30-19)31(28,29)25-11-9-14-5-1-2-6-15(14)13-25/h1-8,10,12H,9,11,13H2,(H,23,26)(H,24,27) |
| InChIKey | UWPOGUXLUQKVGH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.98 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|