C17H21N3O3S2 — CID 119502755
3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N-[2-(methylamino)ethyl]thiophene-2-carboxamide (PubChem CID 119502755) has the molecular formula C17H21N3O3S2 and a molecular weight of 379.51 g/mol. Its IUPAC name is 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N-[2-(methylamino)ethyl]thiophene-2-carboxamide.
| Compound Name | 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N-[2-(methylamino)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 119502755 |
| Molecular Formula | C17H21N3O3S2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N-[2-(methylamino)ethyl]thiophene-2-carboxamide |
| SMILES | CNCCNC(=O)c1sccc1S(=O)(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C17H21N3O3S2/c1-18-8-9-19-17(21)16-15(7-11-24-16)25(22,23)20-10-6-13-4-2-3-5-14(13)12-20/h2-5,7,11,18H,6,8-10,12H2,1H3,(H,19,21) |
| InChIKey | SWHMAQVUHPZYAF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|