C22H28N2O5S2 — CID 36625080
methyl 7-[[3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)thiophene-2-carbonyl]amino]heptanoate (PubChem CID 36625080) has the molecular formula C22H28N2O5S2 and a molecular weight of 464.61 g/mol. Its IUPAC name is methyl 7-[[3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)thiophene-2-carbonyl]amino]heptanoate.
| Compound Name | methyl 7-[[3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)thiophene-2-carbonyl]amino]heptanoate |
|---|---|
| PubChem CID | 36625080 |
| Molecular Formula | C22H28N2O5S2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | methyl 7-[[3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)thiophene-2-carbonyl]amino]heptanoate |
| SMILES | COC(=O)CCCCCCNC(=O)c1sccc1S(=O)(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C22H28N2O5S2/c1-29-20(25)10-4-2-3-7-13-23-22(26)21-19(12-15-30-21)31(27,28)24-14-11-17-8-5-6-9-18(17)16-24/h5-6,8-9,12,15H,2-4,7,10-11,13-14,16H2,1H3,(H,23,26) |
| InChIKey | QAMKAOKDMZRUBS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|