C20H27N3O5S3 — CID 55978797
3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N-[3-[ethyl(methylsulfonyl)amino]propyl]thiophene-2-carboxamide (PubChem CID 55978797) has the molecular formula C20H27N3O5S3 and a molecular weight of 485.65 g/mol. Its IUPAC name is 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N-[3-[ethyl(methylsulfonyl)amino]propyl]thiophene-2-carboxamide.
| Compound Name | 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N-[3-[ethyl(methylsulfonyl)amino]propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55978797 |
| Molecular Formula | C20H27N3O5S3 |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 3-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N-[3-[ethyl(methylsulfonyl)amino]propyl]thiophene-2-carboxamide |
| SMILES | CCN(CCCNC(=O)c1sccc1S(=O)(=O)N1CCc2ccccc2C1)S(C)(=O)=O |
| InChI | InChI=1S/C20H27N3O5S3/c1-3-22(30(2,25)26)12-6-11-21-20(24)19-18(10-14-29-19)31(27,28)23-13-9-16-7-4-5-8-17(16)15-23/h4-5,7-8,10,14H,3,6,9,11-13,15H2,1-2H3,(H,21,24) |
| InChIKey | QUPHIHKRTPUFOL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|