C21H20FN5O5S — CID 24645604
N'-(2-fluoro-5-morpholin-4-ylsulfonylbenzoyl)-3-phenyl-1H-pyrazole-5-carbohydrazide (PubChem CID 24645604) has the molecular formula C21H20FN5O5S and a molecular weight of 473.49 g/mol. Its IUPAC name is N'-(2-fluoro-5-morpholin-4-ylsulfonylbenzoyl)-3-phenyl-1H-pyrazole-5-carbohydrazide.
| Compound Name | N'-(2-fluoro-5-morpholin-4-ylsulfonylbenzoyl)-3-phenyl-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 24645604 |
| Molecular Formula | C21H20FN5O5S |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | N'-(2-fluoro-5-morpholin-4-ylsulfonylbenzoyl)-3-phenyl-1H-pyrazole-5-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1F)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C21H20FN5O5S/c22-17-7-6-15(33(30,31)27-8-10-32-11-9-27)12-16(17)20(28)25-26-21(29)19-13-18(23-24-19)14-4-2-1-3-5-14/h1-7,12-13H,8-11H2,(H,23,24)(H,25,28)(H,26,29) |
| InChIKey | HVEAWSNKTNPAHL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|