C17H21N3O5S3 — CID 55523013
N-[4-(dimethylsulfamoyl)phenyl]-3-pyrrolidin-1-ylsulfonylthiophene-2-carboxamide (PubChem CID 55523013) has the molecular formula C17H21N3O5S3 and a molecular weight of 443.57 g/mol. Its IUPAC name is N-[4-(dimethylsulfamoyl)phenyl]-3-pyrrolidin-1-ylsulfonylthiophene-2-carboxamide.
| Compound Name | N-[4-(dimethylsulfamoyl)phenyl]-3-pyrrolidin-1-ylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 55523013 |
| Molecular Formula | C17H21N3O5S3 |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | N-[4-(dimethylsulfamoyl)phenyl]-3-pyrrolidin-1-ylsulfonylthiophene-2-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(NC(=O)c2sccc2S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C17H21N3O5S3/c1-19(2)27(22,23)14-7-5-13(6-8-14)18-17(21)16-15(9-12-26-16)28(24,25)20-10-3-4-11-20/h5-9,12H,3-4,10-11H2,1-2H3,(H,18,21) |
| InChIKey | JKTIBNSPBKJGNW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |