C20H24N2O3S3 — CID 37400093
N-(4-cyclopentylsulfanylphenyl)-3-pyrrolidin-1-ylsulfonylthiophene-2-carboxamide (PubChem CID 37400093) has the molecular formula C20H24N2O3S3 and a molecular weight of 436.62 g/mol. Its IUPAC name is N-(4-cyclopentylsulfanylphenyl)-3-pyrrolidin-1-ylsulfonylthiophene-2-carboxamide.
| Compound Name | N-(4-cyclopentylsulfanylphenyl)-3-pyrrolidin-1-ylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 37400093 |
| Molecular Formula | C20H24N2O3S3 |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | N-(4-cyclopentylsulfanylphenyl)-3-pyrrolidin-1-ylsulfonylthiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(SC2CCCC2)cc1)c1sccc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C20H24N2O3S3/c23-20(19-18(11-14-26-19)28(24,25)22-12-3-4-13-22)21-15-7-9-17(10-8-15)27-16-5-1-2-6-16/h7-11,14,16H,1-6,12-13H2,(H,21,23) |
| InChIKey | UKRQPZVBPKFTAK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |