C17H20N2O3S3 — CID 60593967
N-(4-ethylphenyl)-3-thiomorpholin-4-ylsulfonylthiophene-2-carboxamide (PubChem CID 60593967) has the molecular formula C17H20N2O3S3 and a molecular weight of 396.56 g/mol. Its IUPAC name is N-(4-ethylphenyl)-3-thiomorpholin-4-ylsulfonylthiophene-2-carboxamide.
| Compound Name | N-(4-ethylphenyl)-3-thiomorpholin-4-ylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 60593967 |
| Molecular Formula | C17H20N2O3S3 |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | N-(4-ethylphenyl)-3-thiomorpholin-4-ylsulfonylthiophene-2-carboxamide |
| SMILES | CCc1ccc(NC(=O)c2sccc2S(=O)(=O)N2CCSCC2)cc1 |
| InChI | InChI=1S/C17H20N2O3S3/c1-2-13-3-5-14(6-4-13)18-17(20)16-15(7-10-24-16)25(21,22)19-8-11-23-12-9-19/h3-7,10H,2,8-9,11-12H2,1H3,(H,18,20) |
| InChIKey | PDHYGOVKLIHDRF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |