C16H17FN2O3S3 — CID 60594204
N-(2-fluoro-4-methylphenyl)-3-thiomorpholin-4-ylsulfonylthiophene-2-carboxamide (PubChem CID 60594204) has the molecular formula C16H17FN2O3S3 and a molecular weight of 400.52 g/mol. Its IUPAC name is N-(2-fluoro-4-methylphenyl)-3-thiomorpholin-4-ylsulfonylthiophene-2-carboxamide.
| Compound Name | N-(2-fluoro-4-methylphenyl)-3-thiomorpholin-4-ylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 60594204 |
| Molecular Formula | C16H17FN2O3S3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | N-(2-fluoro-4-methylphenyl)-3-thiomorpholin-4-ylsulfonylthiophene-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2sccc2S(=O)(=O)N2CCSCC2)c(F)c1 |
| InChI | InChI=1S/C16H17FN2O3S3/c1-11-2-3-13(12(17)10-11)18-16(20)15-14(4-7-24-15)25(21,22)19-5-8-23-9-6-19/h2-4,7,10H,5-6,8-9H2,1H3,(H,18,20) |
| InChIKey | HGCGZBYIXPJRIK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |