C19H22N2O5S2 — CID 24684191
methyl 2-methyl-3-[(3-piperidin-1-ylsulfonylthiophene-2-carbonyl)amino]benzoate (PubChem CID 24684191) has the molecular formula C19H22N2O5S2 and a molecular weight of 422.53 g/mol. Its IUPAC name is methyl 2-methyl-3-[(3-piperidin-1-ylsulfonylthiophene-2-carbonyl)amino]benzoate.
| Compound Name | methyl 2-methyl-3-[(3-piperidin-1-ylsulfonylthiophene-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 24684191 |
| Molecular Formula | C19H22N2O5S2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | methyl 2-methyl-3-[(3-piperidin-1-ylsulfonylthiophene-2-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2sccc2S(=O)(=O)N2CCCCC2)c1C |
| InChI | InChI=1S/C19H22N2O5S2/c1-13-14(19(23)26-2)7-6-8-15(13)20-18(22)17-16(9-12-27-17)28(24,25)21-10-4-3-5-11-21/h6-9,12H,3-5,10-11H2,1-2H3,(H,20,22) |
| InChIKey | KXWLSMIOQNWOKD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |