C16H19N3O4S2 — CID 46665715
N-(6-methoxy-3-pyridinyl)-3-piperidin-1-ylsulfonylthiophene-2-carboxamide (PubChem CID 46665715) has the molecular formula C16H19N3O4S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-(6-methoxy-3-pyridinyl)-3-piperidin-1-ylsulfonylthiophene-2-carboxamide.
| Compound Name | N-(6-methoxy-3-pyridinyl)-3-piperidin-1-ylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 46665715 |
| Molecular Formula | C16H19N3O4S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | N-(6-methoxy-3-pyridinyl)-3-piperidin-1-ylsulfonylthiophene-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2sccc2S(=O)(=O)N2CCCCC2)cn1 |
| InChI | InChI=1S/C16H19N3O4S2/c1-23-14-6-5-12(11-17-14)18-16(20)15-13(7-10-24-15)25(21,22)19-8-3-2-4-9-19/h5-7,10-11H,2-4,8-9H2,1H3,(H,18,20) |
| InChIKey | QZOSOZHNEVXEPJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |