C17H18ClN3O5S — CID 7478552
4-chloro-N-(6-methoxy-3-pyridinyl)-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 7478552) has the molecular formula C17H18ClN3O5S and a molecular weight of 411.87 g/mol. Its IUPAC name is 4-chloro-N-(6-methoxy-3-pyridinyl)-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N-(6-methoxy-3-pyridinyl)-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 7478552 |
| Molecular Formula | C17H18ClN3O5S |
| Molecular Weight | 411.87 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 4-chloro-N-(6-methoxy-3-pyridinyl)-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(Cl)c(S(=O)(=O)N3CCOCC3)c2)cn1 |
| InChI | InChI=1S/C17H18ClN3O5S/c1-25-16-5-3-13(11-19-16)20-17(22)12-2-4-14(18)15(10-12)27(23,24)21-6-8-26-9-7-21/h2-5,10-11H,6-9H2,1H3,(H,20,22) |
| InChIKey | OBYUCTMDVNCKTN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.87 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |