C18H17ClF2N2O5S — CID 26894892
4-chloro-N-[4-(difluoromethoxy)phenyl]-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 26894892) has the molecular formula C18H17ClF2N2O5S and a molecular weight of 446.86 g/mol. Its IUPAC name is 4-chloro-N-[4-(difluoromethoxy)phenyl]-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N-[4-(difluoromethoxy)phenyl]-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 26894892 |
| Molecular Formula | C18H17ClF2N2O5S |
| Molecular Weight | 446.86 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | 4-chloro-N-[4-(difluoromethoxy)phenyl]-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(Nc1ccc(OC(F)F)cc1)c1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C18H17ClF2N2O5S/c19-15-6-1-12(11-16(15)29(25,26)23-7-9-27-10-8-23)17(24)22-13-2-4-14(5-3-13)28-18(20)21/h1-6,11,18H,7-10H2,(H,22,24) |
| InChIKey | RLVGJBJLFZHNLK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.86 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |