C25H26ClN3O7S2 — CID 126355286
4-chloro-N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 126355286) has the molecular formula C25H26ClN3O7S2 and a molecular weight of 580.08 g/mol. Its IUPAC name is 4-chloro-N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 126355286 |
| Molecular Formula | C25H26ClN3O7S2 |
| Molecular Weight | 580.08 g/mol |
| Exact Mass | 579.09 |
| IUPAC Name | 4-chloro-N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc(NC(=O)c3ccc(Cl)c(S(=O)(=O)N4CCOCC4)c3)cc2)cc1 |
| InChI | InChI=1S/C25H26ClN3O7S2/c1-2-36-21-8-4-20(5-9-21)28-37(31,32)22-10-6-19(7-11-22)27-25(30)18-3-12-23(26)24(17-18)38(33,34)29-13-15-35-16-14-29/h3-12,17,28H,2,13-16H2,1H3,(H,27,30) |
| InChIKey | PRRBSKDZRVGJSK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.08 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |