C25H26ClN3O6S2 — CID 126336444
4-chloro-N-[4-[(2,5-dimethylphenyl)sulfamoyl]phenyl]-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 126336444) has the molecular formula C25H26ClN3O6S2 and a molecular weight of 564.09 g/mol. Its IUPAC name is 4-chloro-N-[4-[(2,5-dimethylphenyl)sulfamoyl]phenyl]-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N-[4-[(2,5-dimethylphenyl)sulfamoyl]phenyl]-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 126336444 |
| Molecular Formula | C25H26ClN3O6S2 |
| Molecular Weight | 564.09 g/mol |
| Exact Mass | 563.10 |
| IUPAC Name | 4-chloro-N-[4-[(2,5-dimethylphenyl)sulfamoyl]phenyl]-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | Cc1ccc(C)c(NS(=O)(=O)c2ccc(NC(=O)c3ccc(Cl)c(S(=O)(=O)N4CCOCC4)c3)cc2)c1 |
| InChI | InChI=1S/C25H26ClN3O6S2/c1-17-3-4-18(2)23(15-17)28-36(31,32)21-8-6-20(7-9-21)27-25(30)19-5-10-22(26)24(16-19)37(33,34)29-11-13-35-14-12-29/h3-10,15-16,28H,11-14H2,1-2H3,(H,27,30) |
| InChIKey | KPXILVIDLGHFKN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.09 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |