C15H16ClN3O4S2 — CID 8919530
4-chloro-N-(5-methyl-1,3-thiazol-2-yl)-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 8919530) has the molecular formula C15H16ClN3O4S2 and a molecular weight of 401.90 g/mol. Its IUPAC name is 4-chloro-N-(5-methyl-1,3-thiazol-2-yl)-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N-(5-methyl-1,3-thiazol-2-yl)-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 8919530 |
| Molecular Formula | C15H16ClN3O4S2 |
| Molecular Weight | 401.90 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | 4-chloro-N-(5-methyl-1,3-thiazol-2-yl)-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | Cc1cnc(NC(=O)c2ccc(Cl)c(S(=O)(=O)N3CCOCC3)c2)s1 |
| InChI | InChI=1S/C15H16ClN3O4S2/c1-10-9-17-15(24-10)18-14(20)11-2-3-12(16)13(8-11)25(21,22)19-4-6-23-7-5-19/h2-3,8-9H,4-7H2,1H3,(H,17,18,20) |
| InChIKey | FVRXHIIIOACDOS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.90 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |