C17H19N3O5S2 — CID 55804603
methyl N-[4-[(3-pyrrolidin-1-ylsulfonylthiophene-2-carbonyl)amino]phenyl]carbamate (PubChem CID 55804603) has the molecular formula C17H19N3O5S2 and a molecular weight of 409.49 g/mol. Its IUPAC name is methyl N-[4-[(3-pyrrolidin-1-ylsulfonylthiophene-2-carbonyl)amino]phenyl]carbamate.
| Compound Name | methyl N-[4-[(3-pyrrolidin-1-ylsulfonylthiophene-2-carbonyl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 55804603 |
| Molecular Formula | C17H19N3O5S2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | methyl N-[4-[(3-pyrrolidin-1-ylsulfonylthiophene-2-carbonyl)amino]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(NC(=O)c2sccc2S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C17H19N3O5S2/c1-25-17(22)19-13-6-4-12(5-7-13)18-16(21)15-14(8-11-26-15)27(23,24)20-9-2-3-10-20/h4-8,11H,2-3,9-10H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | WWZQTUJCMVCCKZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |