C10H9ClN5O3+ — CID 135505052
4-chloro-5-nitro-N-(pyridin-1-ium-4-ylmethyl)-1H-pyrazole-3-carboxamide (PubChem CID 135505052) has the molecular formula C10H9ClN5O3+ and a molecular weight of 282.67 g/mol. Its IUPAC name is 4-chloro-5-nitro-N-(pyridin-1-ium-4-ylmethyl)-1H-pyrazole-3-carboxamide.
| Compound Name | 4-chloro-5-nitro-N-(pyridin-1-ium-4-ylmethyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135505052 |
| Molecular Formula | C10H9ClN5O3+ |
| Molecular Weight | 282.67 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 4-chloro-5-nitro-N-(pyridin-1-ium-4-ylmethyl)-1H-pyrazole-3-carboxamide |
| SMILES | O=C(NCc1cc[nH+]cc1)c1n[nH]c([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C10H8ClN5O3/c11-7-8(14-15-9(7)16(18)19)10(17)13-5-6-1-3-12-4-2-6/h1-4H,5H2,(H,13,17)(H,14,15)/p+1 |
| InChIKey | LFJKXYFGVZWMPE-UHFFFAOYSA-O |
| XLogP | 0.72 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.67 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|