C9H6ClF3N6O3 — CID 135523664
4-chloro-5-nitro-N-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]-1H-pyrazole-3-carboxamide (PubChem CID 135523664) has the molecular formula C9H6ClF3N6O3 and a molecular weight of 338.63 g/mol. Its IUPAC name is 4-chloro-5-nitro-N-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]-1H-pyrazole-3-carboxamide.
| Compound Name | 4-chloro-5-nitro-N-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135523664 |
| Molecular Formula | C9H6ClF3N6O3 |
| Molecular Weight | 338.63 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 4-chloro-5-nitro-N-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]-1H-pyrazole-3-carboxamide |
| SMILES | O=C(Nc1cnn(CC(F)(F)F)c1)c1n[nH]c([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C9H6ClF3N6O3/c10-5-6(16-17-7(5)19(21)22)8(20)15-4-1-14-18(2-4)3-9(11,12)13/h1-2H,3H2,(H,15,20)(H,16,17) |
| InChIKey | CCIAXRBOZKLWSX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 118.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.63 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|