C29H31N5O4 — CID 17026609
6-cyclopropyl-3-methyl-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 17026609) has the molecular formula C29H31N5O4 and a molecular weight of 513.60 g/mol. Its IUPAC name is 6-cyclopropyl-3-methyl-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | 6-cyclopropyl-3-methyl-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 17026609 |
| Molecular Formula | C29H31N5O4 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | 6-cyclopropyl-3-methyl-N-[3-nitro-5-(2,3,5-trimethylphenoxy)phenyl]-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | Cc1cc(C)c(C)c(Oc2cc(NC(=O)c3cc(C4CC4)nc4c3c(C)nn4C(C)C)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C29H31N5O4/c1-15(2)33-28-27(19(6)32-33)24(14-25(31-28)20-7-8-20)29(35)30-21-11-22(34(36)37)13-23(12-21)38-26-10-16(3)9-17(4)18(26)5/h9-15,20H,7-8H2,1-6H3,(H,30,35) |
| InChIKey | DJAZKURCIUKRDX-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|