C30H24N4O4 — CID 19473414
5-methyl-N-[3-(4-methylphenoxy)-5-nitrophenyl]-1,3-diphenylpyrazole-4-carboxamide (PubChem CID 19473414) has the molecular formula C30H24N4O4 and a molecular weight of 504.55 g/mol. Its IUPAC name is 5-methyl-N-[3-(4-methylphenoxy)-5-nitrophenyl]-1,3-diphenylpyrazole-4-carboxamide.
| Compound Name | 5-methyl-N-[3-(4-methylphenoxy)-5-nitrophenyl]-1,3-diphenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 19473414 |
| Molecular Formula | C30H24N4O4 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | 5-methyl-N-[3-(4-methylphenoxy)-5-nitrophenyl]-1,3-diphenylpyrazole-4-carboxamide |
| SMILES | Cc1ccc(Oc2cc(NC(=O)c3c(-c4ccccc4)nn(-c4ccccc4)c3C)cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C30H24N4O4/c1-20-13-15-26(16-14-20)38-27-18-23(17-25(19-27)34(36)37)31-30(35)28-21(2)33(24-11-7-4-8-12-24)32-29(28)22-9-5-3-6-10-22/h3-19H,1-2H3,(H,31,35) |
| InChIKey | QDKQSNCSKDEHQV-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|