C21H33NO6 — CID 2922247
1-[2-[2-(3-methyl-5-propan-2-ylphenoxy)ethoxy]ethyl]piperidine;oxalic acid (PubChem CID 2922247) has the molecular formula C21H33NO6 and a molecular weight of 395.50 g/mol. Its IUPAC name is 1-[2-[2-(3-methyl-5-propan-2-ylphenoxy)ethoxy]ethyl]piperidine;oxalic acid.
| Compound Name | 1-[2-[2-(3-methyl-5-propan-2-ylphenoxy)ethoxy]ethyl]piperidine;oxalic acid |
|---|---|
| PubChem CID | 2922247 |
| Molecular Formula | C21H33NO6 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | 1-[2-[2-(3-methyl-5-propan-2-ylphenoxy)ethoxy]ethyl]piperidine;oxalic acid |
| SMILES | Cc1cc(OCCOCCN2CCCCC2)cc(C(C)C)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H31NO2.C2H2O4/c1-16(2)18-13-17(3)14-19(15-18)22-12-11-21-10-9-20-7-5-4-6-8-20;3-1(4)2(5)6/h13-16H,4-12H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | URXSAYLQODUJMR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|