C20H33NO2 — CID 2181705
(2S,6R)-2,6-dimethyl-4-[4-(3-methyl-5-propan-2-ylphenoxy)butyl]morpholine (PubChem CID 2181705) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethyl-4-[4-(3-methyl-5-propan-2-ylphenoxy)butyl]morpholine.
| Compound Name | (2S,6R)-2,6-dimethyl-4-[4-(3-methyl-5-propan-2-ylphenoxy)butyl]morpholine |
|---|---|
| PubChem CID | 2181705 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | (2S,6R)-2,6-dimethyl-4-[4-(3-methyl-5-propan-2-ylphenoxy)butyl]morpholine |
| SMILES | Cc1cc(OCCCCN2C[C@@H](C)O[C@@H](C)C2)cc(C(C)C)c1 |
| InChI | InChI=1S/C20H33NO2/c1-15(2)19-10-16(3)11-20(12-19)22-9-7-6-8-21-13-17(4)23-18(5)14-21/h10-12,15,17-18H,6-9,13-14H2,1-5H3/t17-,18+ |
| InChIKey | GTFXIXHZLGHJRL-HDICACEKSA-N |
| XLogP | 4.39 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|