C22H20BrNO3 — CID 17158211
4-[[(3-bromo-4-phenylmethoxyphenyl)methylamino]methyl]benzoic acid (PubChem CID 17158211) has the molecular formula C22H20BrNO3 and a molecular weight of 426.31 g/mol. Its IUPAC name is 4-[[(3-bromo-4-phenylmethoxyphenyl)methylamino]methyl]benzoic acid.
| Compound Name | 4-[[(3-bromo-4-phenylmethoxyphenyl)methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 17158211 |
| Molecular Formula | C22H20BrNO3 |
| Molecular Weight | 426.31 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 4-[[(3-bromo-4-phenylmethoxyphenyl)methylamino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNCc2ccc(OCc3ccccc3)c(Br)c2)cc1 |
| InChI | InChI=1S/C22H20BrNO3/c23-20-12-18(8-11-21(20)27-15-17-4-2-1-3-5-17)14-24-13-16-6-9-19(10-7-16)22(25)26/h1-12,24H,13-15H2,(H,25,26) |
| InChIKey | GWDYZWZGMYUOAP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.31 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |