C18H23BrClNO2 — CID 17157143
2-[(3-bromo-4-phenylmethoxyphenyl)methylamino]-2-methylpropan-1-ol;hydrochloride (PubChem CID 17157143) has the molecular formula C18H23BrClNO2 and a molecular weight of 400.74 g/mol. Its IUPAC name is 2-[(3-bromo-4-phenylmethoxyphenyl)methylamino]-2-methylpropan-1-ol;hydrochloride.
| Compound Name | 2-[(3-bromo-4-phenylmethoxyphenyl)methylamino]-2-methylpropan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 17157143 |
| Molecular Formula | C18H23BrClNO2 |
| Molecular Weight | 400.74 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 2-[(3-bromo-4-phenylmethoxyphenyl)methylamino]-2-methylpropan-1-ol;hydrochloride |
| SMILES | CC(C)(CO)NCc1ccc(OCc2ccccc2)c(Br)c1.Cl |
| InChI | InChI=1S/C18H22BrNO2.ClH/c1-18(2,13-21)20-11-15-8-9-17(16(19)10-15)22-12-14-6-4-3-5-7-14;/h3-10,20-21H,11-13H2,1-2H3;1H |
| InChIKey | PWCZBSXLIOUQJF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.74 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |