C14H14O4 — CID 174619626
formic acid;3-prop-2-enylnaphthalene-1,2-diol (PubChem CID 174619626) has the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. Its IUPAC name is formic acid;3-prop-2-enylnaphthalene-1,2-diol.
| Compound Name | formic acid;3-prop-2-enylnaphthalene-1,2-diol |
|---|---|
| PubChem CID | 174619626 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | formic acid;3-prop-2-enylnaphthalene-1,2-diol |
| SMILES | C=CCc1cc2ccccc2c(O)c1O.O=CO |
| InChI | InChI=1S/C13H12O2.CH2O2/c1-2-5-10-8-9-6-3-4-7-11(9)13(15)12(10)14;2-1-3/h2-4,6-8,14-15H,1,5H2;1H,(H,2,3) |
| InChIKey | RIKXHVGINBTGKA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|