About 1,4-dimethyl-2-(2-methylphenyl)benzene;methane;2-methylnaphthalene
1,4-dimethyl-2-(2-methylphenyl)benzene;methane;2-methylnaphthalene (PubChem CID 143438669) has the molecular formula C27H30
and a molecular weight of 354.54 g/mol. Its IUPAC name is 1,4-dimethyl-2-(2-methylphenyl)benzene;methane;2-methylnaphthalene.
Molecular Properties
| Compound Name | 1,4-dimethyl-2-(2-methylphenyl)benzene;methane;2-methylnaphthalene |
| PubChem CID | 143438669 |
| Molecular Formula | C27H30 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 1,4-dimethyl-2-(2-methylphenyl)benzene;methane;2-methylnaphthalene |
| SMILES | C.Cc1ccc(C)c(-c2ccccc2C)c1.Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H16.C11H10.CH4/c1-11-8-9-13(3)15(10-11)14-7-5-4-6-12(14)2;1-9-6-7-10-4-2-3-5-11(10)8-9;/h4-10H,1-3H3;2-8H,1H3;1H4 |
| InChIKey | IORIADRWCDVWFD-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,4-dimethyl-2-(2-methylphenyl)benzene;methane;2-methylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethyl-2-(2-methylphenyl)benzene;methane;2-methylnaphthalene?
The IUPAC name of 1,4-dimethyl-2-(2-methylphenyl)benzene;methane;2-methylnaphthalene (CID 143438669) is 1,4-dimethyl-2-(2-methylphenyl)benzene;methane;2-methylnaphthalene.
What is the SMILES notation for 1,4-dimethyl-2-(2-methylphenyl)benzene;methane;2-methylnaphthalene?
The canonical SMILES for 1,4-dimethyl-2-(2-methylphenyl)benzene;methane;2-methylnaphthalene is C.Cc1ccc(C)c(-c2ccccc2C)c1.Cc1ccc2ccccc2c1.
What is the InChIKey of 1,4-dimethyl-2-(2-methylphenyl)benzene;methane;2-methylnaphthalene?
The InChIKey is IORIADRWCDVWFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16.C11H10.CH4/c1-11-8-9-13(3)15(10-11)14-7-5-4-6-12(14)2;1-9-6-7-10-4-2-3-5-11(10)8-9;/h4-10H,1-3H3;2-8H,1H3;1H4.
What are the key properties of 1,4-dimethyl-2-(2-methylphenyl)benzene;methane;2-methylnaphthalene?
1,4-dimethyl-2-(2-methylphenyl)benzene;methane;2-methylnaphthalene has a molecular weight of 354.54 g/mol, XLogP of 8.06, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-2-(2-methylphenyl)benzene;methane;2-methylnaphthalene is sourced from PubChem (CID 143438669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).