C19H26 — CID 142975298
butane;1,4-dimethyl-2-(2-methylphenyl)benzene (PubChem CID 142975298) has the molecular formula C19H26 and a molecular weight of 254.42 g/mol. Its IUPAC name is butane;1,4-dimethyl-2-(2-methylphenyl)benzene.
| Compound Name | butane;1,4-dimethyl-2-(2-methylphenyl)benzene |
|---|---|
| PubChem CID | 142975298 |
| Molecular Formula | C19H26 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | butane;1,4-dimethyl-2-(2-methylphenyl)benzene |
| SMILES | CCCC.Cc1ccc(C)c(-c2ccccc2C)c1 |
| InChI | InChI=1S/C15H16.C4H10/c1-11-8-9-13(3)15(10-11)14-7-5-4-6-12(14)2;1-3-4-2/h4-10H,1-3H3;3-4H2,1-2H3 |
| InChIKey | DCPPFHJWZVKATH-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |