C21H19Cl — CID 174900515
2-[2-[(4-chlorophenyl)methyl]phenyl]-1,4-dimethylbenzene (PubChem CID 174900515) has the molecular formula C21H19Cl and a molecular weight of 306.84 g/mol. Its IUPAC name is 2-[2-[(4-chlorophenyl)methyl]phenyl]-1,4-dimethylbenzene.
| Compound Name | 2-[2-[(4-chlorophenyl)methyl]phenyl]-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 174900515 |
| Molecular Formula | C21H19Cl |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-[2-[(4-chlorophenyl)methyl]phenyl]-1,4-dimethylbenzene |
| SMILES | Cc1ccc(C)c(-c2ccccc2Cc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C21H19Cl/c1-15-7-8-16(2)21(13-15)20-6-4-3-5-18(20)14-17-9-11-19(22)12-10-17/h3-13H,14H2,1-2H3 |
| InChIKey | NYJJSEZNUMGKLU-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |