C20H26O — CID 65150147
2-(4-tert-butylphenyl)-1-(2-ethylphenyl)ethanol (PubChem CID 65150147) has the molecular formula C20H26O and a molecular weight of 282.43 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-1-(2-ethylphenyl)ethanol.
| Compound Name | 2-(4-tert-butylphenyl)-1-(2-ethylphenyl)ethanol |
|---|---|
| PubChem CID | 65150147 |
| Molecular Formula | C20H26O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | 2-(4-tert-butylphenyl)-1-(2-ethylphenyl)ethanol |
| SMILES | CCc1ccccc1C(O)Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H26O/c1-5-16-8-6-7-9-18(16)19(21)14-15-10-12-17(13-11-15)20(2,3)4/h6-13,19,21H,5,14H2,1-4H3 |
| InChIKey | NIBBIRUVRJGVNE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |