C18H26N2O — CID 115990490
2-(4-tert-butylphenyl)-1-(3-ethyl-1-methylpyrazol-4-yl)ethanol (PubChem CID 115990490) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-1-(3-ethyl-1-methylpyrazol-4-yl)ethanol.
| Compound Name | 2-(4-tert-butylphenyl)-1-(3-ethyl-1-methylpyrazol-4-yl)ethanol |
|---|---|
| PubChem CID | 115990490 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 2-(4-tert-butylphenyl)-1-(3-ethyl-1-methylpyrazol-4-yl)ethanol |
| SMILES | CCc1nn(C)cc1C(O)Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H26N2O/c1-6-16-15(12-20(5)19-16)17(21)11-13-7-9-14(10-8-13)18(2,3)4/h7-10,12,17,21H,6,11H2,1-5H3 |
| InChIKey | CCYNYPYQVYHBRF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |