C9H14N2O2S — CID 171873543
1-(3-amino-4-pyridinyl)-4-sulfanylbutane-1,2-diol (PubChem CID 171873543) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 1-(3-amino-4-pyridinyl)-4-sulfanylbutane-1,2-diol.
| Compound Name | 1-(3-amino-4-pyridinyl)-4-sulfanylbutane-1,2-diol |
|---|---|
| PubChem CID | 171873543 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 1-(3-amino-4-pyridinyl)-4-sulfanylbutane-1,2-diol |
| SMILES | Nc1cnccc1C(O)C(O)CCS |
| InChI | InChI=1S/C9H14N2O2S/c10-7-5-11-3-1-6(7)9(13)8(12)2-4-14/h1,3,5,8-9,12-14H,2,4,10H2 |
| InChIKey | LLEVIDUPERCRNQ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|