C10H14ClNO3S — CID 171874197
1-(5-chloro-2-methoxy-3-pyridinyl)-4-sulfanylbutane-1,2-diol (PubChem CID 171874197) has the molecular formula C10H14ClNO3S and a molecular weight of 263.75 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxy-3-pyridinyl)-4-sulfanylbutane-1,2-diol.
| Compound Name | 1-(5-chloro-2-methoxy-3-pyridinyl)-4-sulfanylbutane-1,2-diol |
|---|---|
| PubChem CID | 171874197 |
| Molecular Formula | C10H14ClNO3S |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 1-(5-chloro-2-methoxy-3-pyridinyl)-4-sulfanylbutane-1,2-diol |
| SMILES | COc1ncc(Cl)cc1C(O)C(O)CCS |
| InChI | InChI=1S/C10H14ClNO3S/c1-15-10-7(4-6(11)5-12-10)9(14)8(13)2-3-16/h4-5,8-9,13-14,16H,2-3H2,1H3 |
| InChIKey | LEWRQXIXGNITHP-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|