C11H11FN2O7 — CID 171900130
4-(4-amino-1,2-dihydroxy-4-oxobutyl)-5-fluoro-2-nitrobenzoic acid (PubChem CID 171900130) has the molecular formula C11H11FN2O7 and a molecular weight of 302.21 g/mol. Its IUPAC name is 4-(4-amino-1,2-dihydroxy-4-oxobutyl)-5-fluoro-2-nitrobenzoic acid.
| Compound Name | 4-(4-amino-1,2-dihydroxy-4-oxobutyl)-5-fluoro-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 171900130 |
| Molecular Formula | C11H11FN2O7 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 4-(4-amino-1,2-dihydroxy-4-oxobutyl)-5-fluoro-2-nitrobenzoic acid |
| SMILES | NC(=O)CC(O)C(O)c1cc([N+](=O)[O-])c(C(=O)O)cc1F |
| InChI | InChI=1S/C11H11FN2O7/c12-6-1-5(11(18)19)7(14(20)21)2-4(6)10(17)8(15)3-9(13)16/h1-2,8,10,15,17H,3H2,(H2,13,16)(H,18,19) |
| InChIKey | SJCVLAPYJWXXEZ-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 163.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|