C18H18FN2O2+ — CID 7443652
4-(4-fluorophenyl)-1-[(2-nitrophenyl)methyl]-1,2,3,6-tetrahydropyridin-1-ium (PubChem CID 7443652) has the molecular formula C18H18FN2O2+ and a molecular weight of 313.35 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1-[(2-nitrophenyl)methyl]-1,2,3,6-tetrahydropyridin-1-ium.
| Compound Name | 4-(4-fluorophenyl)-1-[(2-nitrophenyl)methyl]-1,2,3,6-tetrahydropyridin-1-ium |
|---|---|
| PubChem CID | 7443652 |
| Molecular Formula | C18H18FN2O2+ |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 4-(4-fluorophenyl)-1-[(2-nitrophenyl)methyl]-1,2,3,6-tetrahydropyridin-1-ium |
| SMILES | O=[N+]([O-])c1ccccc1C[NH+]1CC=C(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H17FN2O2/c19-17-7-5-14(6-8-17)15-9-11-20(12-10-15)13-16-3-1-2-4-18(16)21(22)23/h1-9H,10-13H2/p+1 |
| InChIKey | DOQWAEMRIKJVQB-UHFFFAOYSA-O |
| XLogP | 2.61 |
| TPSA | 47.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|