C16H24Cl2N2O — CID 119716831
N-[1-(3-chlorophenyl)ethyl]-N-methyl-2-piperidin-4-ylacetamide;hydrochloride (PubChem CID 119716831) has the molecular formula C16H24Cl2N2O and a molecular weight of 331.29 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)ethyl]-N-methyl-2-piperidin-4-ylacetamide;hydrochloride.
| Compound Name | N-[1-(3-chlorophenyl)ethyl]-N-methyl-2-piperidin-4-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119716831 |
| Molecular Formula | C16H24Cl2N2O |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | N-[1-(3-chlorophenyl)ethyl]-N-methyl-2-piperidin-4-ylacetamide;hydrochloride |
| SMILES | CC(c1cccc(Cl)c1)N(C)C(=O)CC1CCNCC1.Cl |
| InChI | InChI=1S/C16H23ClN2O.ClH/c1-12(14-4-3-5-15(17)11-14)19(2)16(20)10-13-6-8-18-9-7-13;/h3-5,11-13,18H,6-10H2,1-2H3;1H |
| InChIKey | SIBBMGLNIYZFCT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |