C16H25ClN2S — CID 114628582
1-(3-chlorophenyl)-N-methyl-N-(2-piperidin-4-ylsulfanylethyl)ethanamine (PubChem CID 114628582) has the molecular formula C16H25ClN2S and a molecular weight of 312.91 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-methyl-N-(2-piperidin-4-ylsulfanylethyl)ethanamine.
| Compound Name | 1-(3-chlorophenyl)-N-methyl-N-(2-piperidin-4-ylsulfanylethyl)ethanamine |
|---|---|
| PubChem CID | 114628582 |
| Molecular Formula | C16H25ClN2S |
| Molecular Weight | 312.91 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1-(3-chlorophenyl)-N-methyl-N-(2-piperidin-4-ylsulfanylethyl)ethanamine |
| SMILES | CC(c1cccc(Cl)c1)N(C)CCSC1CCNCC1 |
| InChI | InChI=1S/C16H25ClN2S/c1-13(14-4-3-5-15(17)12-14)19(2)10-11-20-16-6-8-18-9-7-16/h3-5,12-13,16,18H,6-11H2,1-2H3 |
| InChIKey | WQGWCERFPOGNCR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.91 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |