C14H23ClN2 — CID 81080490
N'-[1-(3-chlorophenyl)ethyl]-N',2-dimethylbutane-1,4-diamine (PubChem CID 81080490) has the molecular formula C14H23ClN2 and a molecular weight of 254.80 g/mol. Its IUPAC name is N'-[1-(3-chlorophenyl)ethyl]-N',2-dimethylbutane-1,4-diamine.
| Compound Name | N'-[1-(3-chlorophenyl)ethyl]-N',2-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 81080490 |
| Molecular Formula | C14H23ClN2 |
| Molecular Weight | 254.80 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N'-[1-(3-chlorophenyl)ethyl]-N',2-dimethylbutane-1,4-diamine |
| SMILES | CC(CN)CCN(C)C(C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H23ClN2/c1-11(10-16)7-8-17(3)12(2)13-5-4-6-14(15)9-13/h4-6,9,11-12H,7-8,10,16H2,1-3H3 |
| InChIKey | JBWZNZDTBJZHKB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.80 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |