C12H18ClN3O — CID 76979743
3-[1-(3-chlorophenyl)ethyl-methylamino]-N'-hydroxypropanimidamide (PubChem CID 76979743) has the molecular formula C12H18ClN3O and a molecular weight of 255.75 g/mol. Its IUPAC name is 3-[1-(3-chlorophenyl)ethyl-methylamino]-N'-hydroxypropanimidamide.
| Compound Name | 3-[1-(3-chlorophenyl)ethyl-methylamino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 76979743 |
| Molecular Formula | C12H18ClN3O |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 3-[1-(3-chlorophenyl)ethyl-methylamino]-N'-hydroxypropanimidamide |
| SMILES | CC(c1cccc(Cl)c1)N(C)CCC(N)=NO |
| InChI | InChI=1S/C12H18ClN3O/c1-9(10-4-3-5-11(13)8-10)16(2)7-6-12(14)15-17/h3-5,8-9,17H,6-7H2,1-2H3,(H2,14,15) |
| InChIKey | VSQLUMUTKKGJGC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|