C14H22ClN3O — CID 55140663
3-[1-(3-chlorophenyl)ethyl-methylamino]-N'-hydroxypentanimidamide (PubChem CID 55140663) has the molecular formula C14H22ClN3O and a molecular weight of 283.80 g/mol. Its IUPAC name is 3-[1-(3-chlorophenyl)ethyl-methylamino]-N'-hydroxypentanimidamide.
| Compound Name | 3-[1-(3-chlorophenyl)ethyl-methylamino]-N'-hydroxypentanimidamide |
|---|---|
| PubChem CID | 55140663 |
| Molecular Formula | C14H22ClN3O |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 3-[1-(3-chlorophenyl)ethyl-methylamino]-N'-hydroxypentanimidamide |
| SMILES | CCC(C/C(N)=N/O)N(C)C(C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H22ClN3O/c1-4-13(9-14(16)17-19)18(3)10(2)11-6-5-7-12(15)8-11/h5-8,10,13,19H,4,9H2,1-3H3,(H2,16,17) |
| InChIKey | WKQJMJWWMPGVSD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|